| Name | Entacapone |
| Synonyms | C071192 Entacapone Novartis brand of entacapone N,N-Diethyl-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)acrylamide 2-Cyano-N,N-diethyl-3-(3,4-dihydroxy-5-nitrophenyl)propenamide 2-Propenamide, 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl- (2E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide (E)-2-Cyano-3-(3,4-dihydroxy-5-nitro-phenyl)-N,N-diethyl-prop-2-enamide 2-cyano-3-(5-dihydroxyamino-3,4-dioxo-1-cyclohexa-1,5-dienyl)-n,n-diethyl-prop-2-enamide |
| CAS | 130929-57-6 116314-67-1 |
| InChI | InChI=1/C14H15N3O5/c1-3-16(4-2)14(20)10(8-15)5-9-6-11(17(21)22)13(19)12(18)7-9/h5-7,18-19H,3-4H2,1-2H3/b10-5+ |
| Molecular Formula | C14H15N3O5 |
| Density | 1.392g/cm3 |
| Boling Point | 526.6°C at 760 mmHg |
| Flash Point | 272.3°C |
| Solubility | Soluble in DMSO (61 mg/ml at 25 °C), methanol, DMF (~30 mg/ml), and ethanol (~5 mg/ml). Insoluble in water |
| Vapor Presure | 1.05E-11mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.641 |
| Use | Entacapone inhibits catechol-O-methyltransferase (COMT) activity, IC50,151 nM. |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 3.276 ml | 16.378 ml | 32.756 ml |
| 5 mM | 0.655 ml | 3.276 ml | 6.551 ml |
| 10 mM | 0.328 ml | 1.638 ml | 3.276 ml |
| 5 mM | 0.066 ml | 0.328 ml | 0.655 ml |